About methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate
methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate (PubChem CID 118020943) has the molecular formula C31H35N2O5+
and a molecular weight of 515.63 g/mol. Its IUPAC name is methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate.
Molecular Properties
| Compound Name | methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate |
| PubChem CID | 118020943 |
| Molecular Formula | C31H35N2O5+ |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate |
| SMILES | CC(=O)OC1C[N+]2(CC(=O)c3ccccc3)CCC1CC2.COC(=O)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H22NO3.C14H13NO2/c1-13(19)21-17-12-18(9-7-15(17)8-10-18)11-16(20)14-5-3-2-4-6-14;1-17-14(16)11-7-9-13(10-8-11)15-12-5-3-2-4-6-12/h2-6,15,17H,7-12H2,1H3;2-10,15H,1H3/q+1; |
| InChIKey | TVTDQEMTLYTLGQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate?
The IUPAC name of methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate (CID 118020943) is methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate.
What is the SMILES notation for methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate?
The canonical SMILES for methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate is CC(=O)OC1C[N+]2(CC(=O)c3ccccc3)CCC1CC2.COC(=O)c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate?
The InChIKey is TVTDQEMTLYTLGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22NO3.C14H13NO2/c1-13(19)21-17-12-18(9-7-15(17)8-10-18)11-16(20)14-5-3-2-4-6-14;1-17-14(16)11-7-9-13(10-8-11)15-12-5-3-2-4-6-12/h2-6,15,17H,7-12H2,1H3;2-10,15H,1H3/q+1;.
What are the key properties of methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate?
methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate has a molecular weight of 515.63 g/mol, XLogP of 5.26, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-anilinobenzoate;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate is sourced from PubChem (CID 118020943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).