About 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide
3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide (PubChem CID 87461586) has the molecular formula C29H32BrFN2O3
and a molecular weight of 555.49 g/mol. Its IUPAC name is 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide.
Molecular Properties
| Compound Name | 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide |
| PubChem CID | 87461586 |
| Molecular Formula | C29H32BrFN2O3 |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide |
| SMILES | CC(=O)OC1C[N+]2(CC(=O)c3ccccc3)CCC1CC2.Fc1cccc(Nc2ccccc2)c1.[Br-] |
| InChI | InChI=1S/C17H22NO3.C12H10FN.BrH/c1-13(19)21-17-12-18(9-7-15(17)8-10-18)11-16(20)14-5-3-2-4-6-14;13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11;/h2-6,15,17H,7-12H2,1H3;1-9,14H;1H/q+1;;/p-1 |
| InChIKey | JQVVDHRRPXBLSO-UHFFFAOYSA-M |
| XLogP | 2.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide?
The IUPAC name of 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide (CID 87461586) is 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide.
What is the SMILES notation for 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide?
The canonical SMILES for 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide is CC(=O)OC1C[N+]2(CC(=O)c3ccccc3)CCC1CC2.Fc1cccc(Nc2ccccc2)c1.[Br-].
What is the InChIKey of 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide?
The InChIKey is JQVVDHRRPXBLSO-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H22NO3.C12H10FN.BrH/c1-13(19)21-17-12-18(9-7-15(17)8-10-18)11-16(20)14-5-3-2-4-6-14;13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11;/h2-6,15,17H,7-12H2,1H3;1-9,14H;1H/q+1;;/p-1.
What are the key properties of 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide?
3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide has a molecular weight of 555.49 g/mol, XLogP of 2.61, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-phenylaniline;(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) acetate;bromide is sourced from PubChem (CID 87461586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).