C28H32ClFN2O3S — CID 87462667
N-[(4-fluorophenyl)methyl]aniline;[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate;chloride (PubChem CID 87462667) has the molecular formula C28H32ClFN2O3S and a molecular weight of 531.09 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]aniline;[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate;chloride.
| Compound Name | N-[(4-fluorophenyl)methyl]aniline;[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate;chloride |
|---|---|
| PubChem CID | 87462667 |
| Molecular Formula | C28H32ClFN2O3S |
| Molecular Weight | 531.09 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]aniline;[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate;chloride |
| SMILES | CC(=O)OC1C[N+]2(CC(=O)c3cccs3)CCC1CC2.Fc1ccc(CNc2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C15H20NO3S.C13H12FN.ClH/c1-11(17)19-14-10-16(6-4-12(14)5-7-16)9-13(18)15-3-2-8-20-15;14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13;/h2-3,8,12,14H,4-7,9-10H2,1H3;1-9,15H,10H2;1H/q+1;;/p-1 |
| InChIKey | LKPJNBYLGBEKJX-UHFFFAOYSA-M |
| XLogP | 2.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.09 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|