C28H28F2NO3S+ — CID 91429609
[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-(3-fluorophenyl)-2-(4-fluorophenyl)propanoate (PubChem CID 91429609) has the molecular formula C28H28F2NO3S+ and a molecular weight of 496.60 g/mol. Its IUPAC name is [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-(3-fluorophenyl)-2-(4-fluorophenyl)propanoate.
| Compound Name | [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-(3-fluorophenyl)-2-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 91429609 |
| Molecular Formula | C28H28F2NO3S+ |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-(3-fluorophenyl)-2-(4-fluorophenyl)propanoate |
| SMILES | O=C(C[N+]12CCC(CC1)C(OC(=O)C(Cc1cccc(F)c1)c1ccc(F)cc1)C2)c1cccs1 |
| InChI | InChI=1S/C28H28F2NO3S/c29-22-8-6-20(7-9-22)24(16-19-3-1-4-23(30)15-19)28(33)34-26-18-31(12-10-21(26)11-13-31)17-25(32)27-5-2-14-35-27/h1-9,14-15,21,24,26H,10-13,16-18H2/q+1 |
| InChIKey | RHDKJNVASDGVBE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|