About 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate
9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate (PubChem CID 75076046) has the molecular formula C27H26NO4S+
and a molecular weight of 460.58 g/mol. Its IUPAC name is 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate.
Molecular Properties
| Compound Name | 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
| PubChem CID | 75076046 |
| Molecular Formula | C27H26NO4S+ |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
| SMILES | O=C(OC1c2ccccc2-c2ccccc21)OC1C[N+]2(CC(=O)c3cccs3)CCC1CC2 |
| InChI | InChI=1S/C27H26NO4S/c29-23(25-10-5-15-33-25)16-28-13-11-18(12-14-28)24(17-28)31-27(30)32-26-21-8-3-1-6-19(21)20-7-2-4-9-22(20)26/h1-10,15,18,24,26H,11-14,16-17H2/q+1 |
| InChIKey | SKAZDQOWBQBVDI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate?
The IUPAC name of 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate (CID 75076046) is 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate.
What is the SMILES notation for 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate?
The canonical SMILES for 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate is O=C(OC1c2ccccc2-c2ccccc21)OC1C[N+]2(CC(=O)c3cccs3)CCC1CC2.
What is the InChIKey of 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate?
The InChIKey is SKAZDQOWBQBVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26NO4S/c29-23(25-10-5-15-33-25)16-28-13-11-18(12-14-28)24(17-28)31-27(30)32-26-21-8-3-1-6-19(21)20-7-2-4-9-22(20)26/h1-10,15,18,24,26H,11-14,16-17H2/q+1.
What are the key properties of 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate?
9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate has a molecular weight of 460.58 g/mol, XLogP of 5.46, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate is sourced from PubChem (CID 75076046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).