C27H26NO4S+ — CID 75076046
9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate (PubChem CID 75076046) has the molecular formula C27H26NO4S+ and a molecular weight of 460.58 g/mol. Its IUPAC name is 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate.
| Compound Name | 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
|---|---|
| PubChem CID | 75076046 |
| Molecular Formula | C27H26NO4S+ |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 9H-fluoren-9-yl [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
| SMILES | O=C(OC1c2ccccc2-c2ccccc21)OC1C[N+]2(CC(=O)c3cccs3)CCC1CC2 |
| InChI | InChI=1S/C27H26NO4S/c29-23(25-10-5-15-33-25)16-28-13-11-18(12-14-28)24(17-28)31-27(30)32-26-21-8-3-1-6-19(21)20-7-2-4-9-22(20)26/h1-10,15,18,24,26H,11-14,16-17H2/q+1 |
| InChIKey | SKAZDQOWBQBVDI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|