C28H36NO3S+ — CID 91286965
[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-cyclohexyl-2-phenylpropanoate (PubChem CID 91286965) has the molecular formula C28H36NO3S+ and a molecular weight of 466.67 g/mol. Its IUPAC name is [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-cyclohexyl-2-phenylpropanoate.
| Compound Name | [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-cyclohexyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 91286965 |
| Molecular Formula | C28H36NO3S+ |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 3-cyclohexyl-2-phenylpropanoate |
| SMILES | O=C(C[N+]12CCC(CC1)C(OC(=O)C(CC1CCCCC1)c1ccccc1)C2)c1cccs1 |
| InChI | InChI=1S/C28H36NO3S/c30-25(27-12-7-17-33-27)19-29-15-13-23(14-16-29)26(20-29)32-28(31)24(22-10-5-2-6-11-22)18-21-8-3-1-4-9-21/h2,5-7,10-12,17,21,23-24,26H,1,3-4,8-9,13-16,18-20H2/q+1 |
| InChIKey | QYMKGIHAELHYJZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|