C30H36N2O5S — CID 87463017
N-[(4-methylphenyl)methyl]aniline;[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate;formate (PubChem CID 87463017) has the molecular formula C30H36N2O5S and a molecular weight of 536.69 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]aniline;[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate;formate.
| Compound Name | N-[(4-methylphenyl)methyl]aniline;[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate;formate |
|---|---|
| PubChem CID | 87463017 |
| Molecular Formula | C30H36N2O5S |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | N-[(4-methylphenyl)methyl]aniline;[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] acetate;formate |
| SMILES | CC(=O)OC1C[N+]2(CC(=O)c3cccs3)CCC1CC2.Cc1ccc(CNc2ccccc2)cc1.O=C[O-] |
| InChI | InChI=1S/C15H20NO3S.C14H15N.CH2O2/c1-11(17)19-14-10-16(6-4-12(14)5-7-16)9-13(18)15-3-2-8-20-15;1-12-7-9-13(10-8-12)11-15-14-5-3-2-4-6-14;2-1-3/h2-3,8,12,14H,4-7,9-10H2,1H3;2-10,15H,11H2,1H3;1H,(H,2,3)/q+1;;/p-1 |
| InChIKey | NKBQMUSKDICUHT-UHFFFAOYSA-M |
| XLogP | 4.08 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|