C27H27F2N2O3S+ — CID 75217995
[1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(3-fluoroanilino)-2-(3-fluorophenyl)acetate (PubChem CID 75217995) has the molecular formula C27H27F2N2O3S+ and a molecular weight of 497.59 g/mol. Its IUPAC name is [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(3-fluoroanilino)-2-(3-fluorophenyl)acetate.
| Compound Name | [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(3-fluoroanilino)-2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 75217995 |
| Molecular Formula | C27H27F2N2O3S+ |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | [1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(3-fluoroanilino)-2-(3-fluorophenyl)acetate |
| SMILES | O=C(C[N+]12CCC(CC1)C(OC(=O)C(Nc1cccc(F)c1)c1cccc(F)c1)C2)c1cccs1 |
| InChI | InChI=1S/C27H27F2N2O3S/c28-20-5-1-4-19(14-20)26(30-22-7-2-6-21(29)15-22)27(33)34-24-17-31(11-9-18(24)10-12-31)16-23(32)25-8-3-13-35-25/h1-8,13-15,18,24,26,30H,9-12,16-17H2/q+1 |
| InChIKey | KHGDMYGGQZPGDK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|