C27H26F2NO4S+ — CID 44816997
bis(4-fluorophenyl)methyl [(3R)-1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate (PubChem CID 44816997) has the molecular formula C27H26F2NO4S+ and a molecular weight of 498.57 g/mol. Its IUPAC name is bis(4-fluorophenyl)methyl [(3R)-1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate.
| Compound Name | bis(4-fluorophenyl)methyl [(3R)-1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
|---|---|
| PubChem CID | 44816997 |
| Molecular Formula | C27H26F2NO4S+ |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | bis(4-fluorophenyl)methyl [(3R)-1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
| SMILES | O=C(OC(c1ccc(F)cc1)c1ccc(F)cc1)O[C@H]1C[N+]2(CC(=O)c3cccs3)CCC1CC2 |
| InChI | InChI=1S/C27H26F2NO4S/c28-21-7-3-19(4-8-21)26(20-5-9-22(29)10-6-20)34-27(32)33-24-17-30(13-11-18(24)12-14-30)16-23(31)25-2-1-15-35-25/h1-10,15,18,24,26H,11-14,16-17H2/q+1/t18?,24-,30?/m0/s1 |
| InChIKey | CAYZPYXQCKBKNE-DPXQPOCBSA-N |
| XLogP | 5.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|