C29H30F2NO4+ — CID 66627963
bis(3-fluorophenyl)methyl [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate (PubChem CID 66627963) has the molecular formula C29H30F2NO4+ and a molecular weight of 494.56 g/mol. Its IUPAC name is bis(3-fluorophenyl)methyl [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate.
| Compound Name | bis(3-fluorophenyl)methyl [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
|---|---|
| PubChem CID | 66627963 |
| Molecular Formula | C29H30F2NO4+ |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | bis(3-fluorophenyl)methyl [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate |
| SMILES | O=C(OC(c1cccc(F)c1)c1cccc(F)c1)OC1C[N+]2(CCOc3ccccc3)CCC1CC2 |
| InChI | InChI=1S/C29H30F2NO4/c30-24-8-4-6-22(18-24)28(23-7-5-9-25(31)19-23)36-29(33)35-27-20-32(14-12-21(27)13-15-32)16-17-34-26-10-2-1-3-11-26/h1-11,18-19,21,27-28H,12-17,20H2/q+1 |
| InChIKey | NYXAHTPLZBZAGP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|