C29H28F2NO3+ — CID 86672937
bis(3-fluorophenyl)methyl 1-phenacyl-1-azoniabicyclo[2.2.2]octane-3-carboxylate (PubChem CID 86672937) has the molecular formula C29H28F2NO3+ and a molecular weight of 476.54 g/mol. Its IUPAC name is bis(3-fluorophenyl)methyl 1-phenacyl-1-azoniabicyclo[2.2.2]octane-3-carboxylate.
| Compound Name | bis(3-fluorophenyl)methyl 1-phenacyl-1-azoniabicyclo[2.2.2]octane-3-carboxylate |
|---|---|
| PubChem CID | 86672937 |
| Molecular Formula | C29H28F2NO3+ |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | bis(3-fluorophenyl)methyl 1-phenacyl-1-azoniabicyclo[2.2.2]octane-3-carboxylate |
| SMILES | O=C(C[N+]12CCC(CC1)C(C(=O)OC(c1cccc(F)c1)c1cccc(F)c1)C2)c1ccccc1 |
| InChI | InChI=1S/C29H28F2NO3/c30-24-10-4-8-22(16-24)28(23-9-5-11-25(31)17-23)35-29(34)26-18-32(14-12-20(26)13-15-32)19-27(33)21-6-2-1-3-7-21/h1-11,16-17,20,26,28H,12-15,18-19H2/q+1 |
| InChIKey | XPPMIEGVQAMNQV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|