C30H29ClF2NO3+ — CID 158792276
bis(3-fluorophenyl)methyl 2-[(3R)-1-[2-(4-chlorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]acetate (PubChem CID 158792276) has the molecular formula C30H29ClF2NO3+ and a molecular weight of 525.02 g/mol. Its IUPAC name is bis(3-fluorophenyl)methyl 2-[(3R)-1-[2-(4-chlorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]acetate.
| Compound Name | bis(3-fluorophenyl)methyl 2-[(3R)-1-[2-(4-chlorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]acetate |
|---|---|
| PubChem CID | 158792276 |
| Molecular Formula | C30H29ClF2NO3+ |
| Molecular Weight | 525.02 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | bis(3-fluorophenyl)methyl 2-[(3R)-1-[2-(4-chlorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl]acetate |
| SMILES | O=C(C[C@H]1C[N+]2(CC(=O)c3ccc(Cl)cc3)CCC1CC2)OC(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C30H29ClF2NO3/c31-25-9-7-21(8-10-25)28(35)19-34-13-11-20(12-14-34)24(18-34)17-29(36)37-30(22-3-1-5-26(32)15-22)23-4-2-6-27(33)16-23/h1-10,15-16,20,24,30H,11-14,17-19H2/q+1/t20?,24-,34?/m0/s1 |
| InChIKey | ISKUJSLYFRJJAE-VVIFUPKXSA-N |
| XLogP | 6.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.02 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|