C31H28F2NO3S+ — CID 89106404
bis(3-fluorophenyl)methyl 1-[2-(1-benzothiophen-5-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octane-3-carboxylate (PubChem CID 89106404) has the molecular formula C31H28F2NO3S+ and a molecular weight of 532.63 g/mol. Its IUPAC name is bis(3-fluorophenyl)methyl 1-[2-(1-benzothiophen-5-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octane-3-carboxylate.
| Compound Name | bis(3-fluorophenyl)methyl 1-[2-(1-benzothiophen-5-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octane-3-carboxylate |
|---|---|
| PubChem CID | 89106404 |
| Molecular Formula | C31H28F2NO3S+ |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | bis(3-fluorophenyl)methyl 1-[2-(1-benzothiophen-5-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octane-3-carboxylate |
| SMILES | O=C(C[N+]12CCC(CC1)C(C(=O)OC(c1cccc(F)c1)c1cccc(F)c1)C2)c1ccc2sccc2c1 |
| InChI | InChI=1S/C31H28F2NO3S/c32-25-5-1-3-23(16-25)30(24-4-2-6-26(33)17-24)37-31(36)27-18-34(12-9-20(27)10-13-34)19-28(35)21-7-8-29-22(15-21)11-14-38-29/h1-8,11,14-17,20,27,30H,9-10,12-13,18-19H2/q+1 |
| InChIKey | LWFREMSXNYQZMM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|