C28H34BrFN2O3 — CID 71616072
[(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylacetate bromide (PubChem CID 71616072) has the molecular formula C28H34BrFN2O3 and a molecular weight of 545.49 g/mol. Its IUPAC name is [(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylacetate bromide.
| Compound Name | [(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylacetate bromide |
|---|---|
| PubChem CID | 71616072 |
| Molecular Formula | C28H34BrFN2O3 |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | [(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylacetate bromide |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)[C@H](c1ccccc1)N1CCCCC1)C2)c1cccc(F)c1.[Br-] |
| InChI | InChI=1S/C28H34FN2O3.BrH/c29-24-11-7-10-23(18-24)25(32)19-31-16-12-21(13-17-31)26(20-31)34-28(33)27(22-8-3-1-4-9-22)30-14-5-2-6-15-30;/h1,3-4,7-11,18,21,26-27H,2,5-6,12-17,19-20H2;1H/q+1;/p-1/t21?,26-,27-,31?;/m0./s1 |
| InChIKey | UFFWOTABGPLLJI-RYNNJJSYSA-M |
| XLogP | 1.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|