C29H36ClN3O4 — CID 86688906
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(4-acetylpiperazin-1-yl)-2-phenylacetate chloride (PubChem CID 86688906) has the molecular formula C29H36ClN3O4 and a molecular weight of 526.08 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(4-acetylpiperazin-1-yl)-2-phenylacetate chloride.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(4-acetylpiperazin-1-yl)-2-phenylacetate chloride |
|---|---|
| PubChem CID | 86688906 |
| Molecular Formula | C29H36ClN3O4 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(4-acetylpiperazin-1-yl)-2-phenylacetate chloride |
| SMILES | CC(=O)N1CCN(C(C(=O)O[C@H]2C[N+]3(CC(=O)c4ccccc4)CCC2CC3)c2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C29H36N3O4.ClH/c1-22(33)30-14-16-31(17-15-30)28(25-10-6-3-7-11-25)29(35)36-27-21-32(18-12-24(27)13-19-32)20-26(34)23-8-4-2-5-9-23;/h2-11,24,27-28H,12-21H2,1H3;1H/q+1;/p-1/t24?,27-,28?,32?;/m0./s1 |
| InChIKey | PPPWRXDWHNNFGH-VITOZMELSA-M |
| XLogP | -0.07 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|