C29H37N2O3+ — CID 86688890
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(4-methylpiperidin-1-yl)-2-phenylacetate (PubChem CID 86688890) has the molecular formula C29H37N2O3+ and a molecular weight of 461.63 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(4-methylpiperidin-1-yl)-2-phenylacetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(4-methylpiperidin-1-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 86688890 |
| Molecular Formula | C29H37N2O3+ |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(4-methylpiperidin-1-yl)-2-phenylacetate |
| SMILES | CC1CCN(C(C(=O)O[C@H]2C[N+]3(CC(=O)c4ccccc4)CCC2CC3)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H37N2O3/c1-22-12-16-30(17-13-22)28(25-10-6-3-7-11-25)29(33)34-27-21-31(18-14-24(27)15-19-31)20-26(32)23-8-4-2-5-9-23/h2-11,22,24,27-28H,12-21H2,1H3/q+1/t24?,27-,28?,31?/m0/s1 |
| InChIKey | JHSQLPGISFHLKY-USJDDBKOSA-N |
| XLogP | 4.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|