C26H32ClN2O3S+ — CID 71616195
[(3R)-1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylacetate (PubChem CID 71616195) has the molecular formula C26H32ClN2O3S+ and a molecular weight of 488.07 g/mol. Its IUPAC name is [(3R)-1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylacetate.
| Compound Name | [(3R)-1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 71616195 |
| Molecular Formula | C26H32ClN2O3S+ |
| Molecular Weight | 488.07 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | [(3R)-1-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)[C@H](c1ccccc1)N1CCCCC1)C2)c1ccc(Cl)s1 |
| InChI | InChI=1S/C26H32ClN2O3S/c27-24-10-9-23(33-24)21(30)17-29-15-11-19(12-16-29)22(18-29)32-26(31)25(20-7-3-1-4-8-20)28-13-5-2-6-14-28/h1,3-4,7-10,19,22,25H,2,5-6,11-18H2/q+1/t19?,22-,25-,29?/m0/s1 |
| InChIKey | QMSGBQOGHBEEKQ-FBIBMAEDSA-N |
| XLogP | 4.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.07 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|