C29H35ClN4O3 — CID 86688881
[(3R)-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylacetate chloride (PubChem CID 86688881) has the molecular formula C29H35ClN4O3 and a molecular weight of 523.08 g/mol. Its IUPAC name is [(3R)-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylacetate chloride.
| Compound Name | [(3R)-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylacetate chloride |
|---|---|
| PubChem CID | 86688881 |
| Molecular Formula | C29H35ClN4O3 |
| Molecular Weight | 523.08 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | [(3R)-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylacetate chloride |
| SMILES | O=C(O[C@H]1C[N+]2(Cc3noc(-c4ccccc4)n3)CCC1CC2)C(c1ccccc1)N1CCCCC1.[Cl-] |
| InChI | InChI=1S/C29H35N4O3.ClH/c34-29(27(23-10-4-1-5-11-23)32-16-8-3-9-17-32)35-25-20-33(18-14-22(25)15-19-33)21-26-30-28(36-31-26)24-12-6-2-7-13-24;/h1-2,4-7,10-13,22,25,27H,3,8-9,14-21H2;1H/q+1;/p-1/t22?,25-,27?,33?;/m0./s1 |
| InChIKey | OAODAHAZEANEIE-SFPQPCFKSA-M |
| XLogP | 1.62 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.08 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|