C31H33N4O4+ — CID 76828794
[1-[[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate (PubChem CID 76828794) has the molecular formula C31H33N4O4+ and a molecular weight of 525.63 g/mol. Its IUPAC name is [1-[[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate.
| Compound Name | [1-[[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 76828794 |
| Molecular Formula | C31H33N4O4+ |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | [1-[[5-(3-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
| SMILES | COc1cccc(-c2nc(C[N+]34CCC(CC3)C(OC(=O)C(Nc3ccccc3)c3ccccc3)C4)no2)c1 |
| InChI | InChI=1S/C31H33N4O4/c1-37-26-14-8-11-24(19-26)30-33-28(34-39-30)21-35-17-15-22(16-18-35)27(20-35)38-31(36)29(23-9-4-2-5-10-23)32-25-12-6-3-7-13-25/h2-14,19,22,27,29,32H,15-18,20-21H2,1H3/q+1 |
| InChIKey | WCWOKBFFEYQBMP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|