C30H31N4O3+ — CID 54766235
[(3R)-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate (PubChem CID 54766235) has the molecular formula C30H31N4O3+ and a molecular weight of 495.60 g/mol. Its IUPAC name is [(3R)-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 54766235 |
| Molecular Formula | C30H31N4O3+ |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [(3R)-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
| SMILES | O=C(O[C@H]1C[N+]2(Cc3noc(-c4ccccc4)n3)CCC1CC2)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31N4O3/c35-30(28(23-10-4-1-5-11-23)31-25-14-8-3-9-15-25)36-26-20-34(18-16-22(26)17-19-34)21-27-32-29(37-33-27)24-12-6-2-7-13-24/h1-15,22,26,28,31H,16-21H2/q+1/t22?,26-,28+,34?/m0/s1 |
| InChIKey | SUPVUIXKADTKOW-WUYSMAAJSA-N |
| XLogP | 5.24 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|