C29H31N4O2+ — CID 58556948
[(3R)-1-(1H-benzimidazol-2-ylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate (PubChem CID 58556948) has the molecular formula C29H31N4O2+ and a molecular weight of 467.59 g/mol. Its IUPAC name is [(3R)-1-(1H-benzimidazol-2-ylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-(1H-benzimidazol-2-ylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 58556948 |
| Molecular Formula | C29H31N4O2+ |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | [(3R)-1-(1H-benzimidazol-2-ylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
| SMILES | O=C(O[C@H]1C[N+]2(Cc3nc4ccccc4[nH]3)CCC1CC2)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31N4O2/c34-29(28(22-9-3-1-4-10-22)30-23-11-5-2-6-12-23)35-26-19-33(17-15-21(26)16-18-33)20-27-31-24-13-7-8-14-25(24)32-27/h1-14,21,26,28,30H,15-20H2,(H,31,32)/q+1/t21?,26-,28+,33?/m0/s1 |
| InChIKey | FKHYJDYZSHFYFU-ADTDITLUSA-N |
| XLogP | 5.07 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|