C31H31FN3O3+ — CID 58556943
[(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(3-fluorophenyl)acetate (PubChem CID 58556943) has the molecular formula C31H31FN3O3+ and a molecular weight of 512.61 g/mol. Its IUPAC name is [(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(3-fluorophenyl)acetate.
| Compound Name | [(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 58556943 |
| Molecular Formula | C31H31FN3O3+ |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | [(3R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(3-fluorophenyl)acetate |
| SMILES | O=C(O[C@H]1C[N+]2(Cc3coc(-c4ccccc4)n3)CCC1CC2)C(Nc1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C31H31FN3O3/c32-25-11-7-10-24(18-25)29(33-26-12-5-2-6-13-26)31(36)38-28-20-35(16-14-22(28)15-17-35)19-27-21-37-30(34-27)23-8-3-1-4-9-23/h1-13,18,21-22,28-29,33H,14-17,19-20H2/q+1/t22?,28-,29?,35?/m0/s1 |
| InChIKey | CXHIMYJGBMPDKL-YINJSUDMSA-N |
| XLogP | 5.99 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|