C25H32N3O3S+ — CID 86688878
[(3R)-1-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylacetate (PubChem CID 86688878) has the molecular formula C25H32N3O3S+ and a molecular weight of 454.62 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylacetate.
| Compound Name | [(3R)-1-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 86688878 |
| Molecular Formula | C25H32N3O3S+ |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-piperidin-1-ylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(c1ccccc1)N1CCCCC1)C2)c1nccs1 |
| InChI | InChI=1S/C25H32N3O3S/c29-21(24-26-11-16-32-24)17-28-14-9-19(10-15-28)22(18-28)31-25(30)23(20-7-3-1-4-8-20)27-12-5-2-6-13-27/h1,3-4,7-8,11,16,19,22-23H,2,5-6,9-10,12-15,17-18H2/q+1/t19?,22-,23?,28?/m0/s1 |
| InChIKey | XQDCDBUQCVBHNV-QNIZANKTSA-N |
| XLogP | 3.71 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|