C28H28BrN3O3S2 — CID 54765170
[(3R)-1-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(1-benzothiophen-3-yl)acetate bromide (PubChem CID 54765170) has the molecular formula C28H28BrN3O3S2 and a molecular weight of 598.59 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(1-benzothiophen-3-yl)acetate bromide.
| Compound Name | [(3R)-1-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(1-benzothiophen-3-yl)acetate bromide |
|---|---|
| PubChem CID | 54765170 |
| Molecular Formula | C28H28BrN3O3S2 |
| Molecular Weight | 598.59 g/mol |
| Exact Mass | 597.08 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(1-benzothiophen-3-yl)acetate bromide |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(Nc1ccccc1)c1csc3ccccc13)C2)c1nccs1.[Br-] |
| InChI | InChI=1S/C28H28N3O3S2.BrH/c32-23(27-29-12-15-35-27)16-31-13-10-19(11-14-31)24(17-31)34-28(33)26(30-20-6-2-1-3-7-20)22-18-36-25-9-5-4-8-21(22)25;/h1-9,12,15,18-19,24,26,30H,10-11,13-14,16-17H2;1H/q+1;/p-1/t19?,24-,26?,31?;/m0./s1 |
| InChIKey | LDABQRXDWZZRJP-FAWQRSSLSA-M |
| XLogP | 2.55 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|