C24H26N2O3S — CID 67124917
1-azabicyclo[2.2.2]octan-3-yl 2-(1-benzothiophen-3-yl)-2-(3-methoxyanilino)acetate (PubChem CID 67124917) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 2-(1-benzothiophen-3-yl)-2-(3-methoxyanilino)acetate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 2-(1-benzothiophen-3-yl)-2-(3-methoxyanilino)acetate |
|---|---|
| PubChem CID | 67124917 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 2-(1-benzothiophen-3-yl)-2-(3-methoxyanilino)acetate |
| SMILES | COc1cccc(NC(C(=O)OC2CN3CCC2CC3)c2csc3ccccc23)c1 |
| InChI | InChI=1S/C24H26N2O3S/c1-28-18-6-4-5-17(13-18)25-23(20-15-30-22-8-3-2-7-19(20)22)24(27)29-21-14-26-11-9-16(21)10-12-26/h2-8,13,15-16,21,23,25H,9-12,14H2,1H3 |
| InChIKey | WWLHKJIUILKMSF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |