C21H23FN2O2 — CID 59401183
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(2-fluorophenyl)acetate (PubChem CID 59401183) has the molecular formula C21H23FN2O2 and a molecular weight of 354.42 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(2-fluorophenyl)acetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 59401183 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(2-fluorophenyl)acetate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)C(Nc1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C21H23FN2O2/c22-18-9-5-4-8-17(18)20(23-16-6-2-1-3-7-16)21(25)26-19-14-24-12-10-15(19)11-13-24/h1-9,15,19-20,23H,10-14H2/t19-,20?/m0/s1 |
| InChIKey | GIDJPFOKOVKZSX-XJDOXCRVSA-N |
| XLogP | 3.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |