C23H26N2O4 — CID 46840421
methyl 4-[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1-phenylethyl]amino]benzoate (PubChem CID 46840421) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl 4-[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1-phenylethyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1-phenylethyl]amino]benzoate |
|---|---|
| PubChem CID | 46840421 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl 4-[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1-phenylethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(C(=O)O[C@H]2CN3CCC2CC3)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O4/c1-28-22(26)18-7-9-19(10-8-18)24-21(17-5-3-2-4-6-17)23(27)29-20-15-25-13-11-16(20)12-14-25/h2-10,16,20-21,24H,11-15H2,1H3/t20-,21?/m0/s1 |
| InChIKey | USMKCDPJCXRVHE-BGERDNNASA-N |
| XLogP | 3.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |