C20H23N3O3S — CID 54763973
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[(2-carbamoylthiophen-3-yl)amino]-2-phenylacetate (PubChem CID 54763973) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[(2-carbamoylthiophen-3-yl)amino]-2-phenylacetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[(2-carbamoylthiophen-3-yl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 54763973 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[(2-carbamoylthiophen-3-yl)amino]-2-phenylacetate |
| SMILES | NC(=O)c1sccc1NC(C(=O)O[C@H]1CN2CCC1CC2)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O3S/c21-19(24)18-15(8-11-27-18)22-17(14-4-2-1-3-5-14)20(25)26-16-12-23-9-6-13(16)7-10-23/h1-5,8,11,13,16-17,22H,6-7,9-10,12H2,(H2,21,24)/t16-,17?/m0/s1 |
| InChIKey | PWSVFOSAZQUSGB-BHWOMJMDSA-N |
| XLogP | 2.64 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |