C15H20N2O2 — CID 86720689
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2R)-2-amino-2-phenylacetate (PubChem CID 86720689) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2R)-2-amino-2-phenylacetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2R)-2-amino-2-phenylacetate |
|---|---|
| PubChem CID | 86720689 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2R)-2-amino-2-phenylacetate |
| SMILES | N[C@@H](C(=O)O[C@H]1CN2CCC1CC2)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c16-14(12-4-2-1-3-5-12)15(18)19-13-10-17-8-6-11(13)7-9-17/h1-5,11,13-14H,6-10,16H2/t13-,14+/m0/s1 |
| InChIKey | VLBMKLSIDJGRDV-UONOGXRCSA-N |
| XLogP | 1.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |