C15H21Cl3N2O2 — CID 67606496
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-(4-chlorophenyl)acetate;dihydrochloride (PubChem CID 67606496) has the molecular formula C15H21Cl3N2O2 and a molecular weight of 367.70 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-(4-chlorophenyl)acetate;dihydrochloride.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-(4-chlorophenyl)acetate;dihydrochloride |
|---|---|
| PubChem CID | 67606496 |
| Molecular Formula | C15H21Cl3N2O2 |
| Molecular Weight | 367.70 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-(4-chlorophenyl)acetate;dihydrochloride |
| SMILES | Cl.Cl.NC(C(=O)O[C@H]1CN2CCC1CC2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClN2O2.2ClH/c16-12-3-1-11(2-4-12)14(17)15(19)20-13-9-18-7-5-10(13)6-8-18;;/h1-4,10,13-14H,5-9,17H2;2*1H/t13-,14?;;/m0../s1 |
| InChIKey | LTMIOTSWXQDIQF-RBUUAABPSA-N |
| XLogP | 2.82 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |