C16H24Cl2N2O2 — CID 67607085
1-azabicyclo[2.2.2]octan-3-yl 2-amino-2-(4-methylphenyl)acetate;dihydrochloride (PubChem CID 67607085) has the molecular formula C16H24Cl2N2O2 and a molecular weight of 347.29 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 2-amino-2-(4-methylphenyl)acetate;dihydrochloride.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 2-amino-2-(4-methylphenyl)acetate;dihydrochloride |
|---|---|
| PubChem CID | 67607085 |
| Molecular Formula | C16H24Cl2N2O2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 2-amino-2-(4-methylphenyl)acetate;dihydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)OC2CN3CCC2CC3)cc1.Cl.Cl |
| InChI | InChI=1S/C16H22N2O2.2ClH/c1-11-2-4-13(5-3-11)15(17)16(19)20-14-10-18-8-6-12(14)7-9-18;;/h2-5,12,14-15H,6-10,17H2,1H3;2*1H |
| InChIKey | QSWCKZVWBQKMET-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |