C16H25NO — CID 143919466
ethane;3-(4-methylphenoxy)-1-azabicyclo[2.2.2]octane (PubChem CID 143919466) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is ethane;3-(4-methylphenoxy)-1-azabicyclo[2.2.2]octane.
| Compound Name | ethane;3-(4-methylphenoxy)-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 143919466 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | ethane;3-(4-methylphenoxy)-1-azabicyclo[2.2.2]octane |
| SMILES | CC.Cc1ccc(OC2CN3CCC2CC3)cc1 |
| InChI | InChI=1S/C14H19NO.C2H6/c1-11-2-4-13(5-3-11)16-14-10-15-8-6-12(14)7-9-15;1-2/h2-5,12,14H,6-10H2,1H3;1-2H3 |
| InChIKey | GGWYJDCKTCLHJT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |