C24H28N2O5 — CID 69431498
5-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]phenyl]-2-methylaniline;but-2-enedioic acid (PubChem CID 69431498) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 5-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]phenyl]-2-methylaniline;but-2-enedioic acid.
| Compound Name | 5-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]phenyl]-2-methylaniline;but-2-enedioic acid |
|---|---|
| PubChem CID | 69431498 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 5-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]phenyl]-2-methylaniline;but-2-enedioic acid |
| SMILES | Cc1ccc(-c2ccc(O[C@H]3CN4CCC3CC4)cc2)cc1N.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H24N2O.C4H4O4/c1-14-2-3-17(12-19(14)21)15-4-6-18(7-5-15)23-20-13-22-10-8-16(20)9-11-22;5-3(6)1-2-4(7)8/h2-7,12,16,20H,8-11,13,21H2,1H3;1-2H,(H,5,6)(H,7,8)/t20-;/m0./s1 |
| InChIKey | BDFJYSQYKGEDKZ-BDQAORGHSA-N |
| XLogP | 3.43 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|