C23H23N3O5 — CID 160521461
(E)-but-2-enedioic acid;(3R)-3-[6-(2-phenylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane (PubChem CID 160521461) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(3R)-3-[6-(2-phenylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane.
| Compound Name | (E)-but-2-enedioic acid;(3R)-3-[6-(2-phenylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 160521461 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (E)-but-2-enedioic acid;(3R)-3-[6-(2-phenylethynyl)pyridazin-3-yl]oxy-1-azabicyclo[2.2.2]octane |
| SMILES | C(#Cc1ccc(O[C@H]2CN3CCC2CC3)nn1)c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H19N3O.C4H4O4/c1-2-4-15(5-3-1)6-7-17-8-9-19(21-20-17)23-18-14-22-12-10-16(18)11-13-22;5-3(6)1-2-4(7)8/h1-5,8-9,16,18H,10-14H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t18-;/m0./s1 |
| InChIKey | QUICRFLMFHPXBX-GCQRLXCUSA-N |
| XLogP | 2.06 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|