C23H24N4O5 — CID 67070112
3-[6-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]-1H-indole;(E)-but-2-enedioic acid (PubChem CID 67070112) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 3-[6-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]-1H-indole;(E)-but-2-enedioic acid.
| Compound Name | 3-[6-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]-1H-indole;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 67070112 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-[6-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]-1H-indole;(E)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc2c(-c3ccc(O[C@@H]4CN5CCC4CC5)nn3)c[nH]c2c1 |
| InChI | InChI=1S/C19H20N4O.C4H4O4/c1-2-4-16-14(3-1)15(11-20-16)17-5-6-19(22-21-17)24-18-12-23-9-7-13(18)8-10-23;5-3(6)1-2-4(7)8/h1-6,11,13,18,20H,7-10,12H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t18-;/m1./s1 |
| InChIKey | QPJQLJUKCLAPBF-GBSOSOQXSA-N |
| XLogP | 2.81 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|