C22H23N5O4 — CID 162339514
(E)-but-2-enedioic acid;3-[6-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]pyridazin-3-yl]-1H-indole (PubChem CID 162339514) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[6-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]pyridazin-3-yl]-1H-indole.
| Compound Name | (E)-but-2-enedioic acid;3-[6-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]pyridazin-3-yl]-1H-indole |
|---|---|
| PubChem CID | 162339514 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[6-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]pyridazin-3-yl]-1H-indole |
| SMILES | CN1C[C@@H]2CN(c3ccc(-c4c[nH]c5ccccc45)nn3)C[C@@H]21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H19N5.C4H4O4/c1-22-9-12-10-23(11-17(12)22)18-7-6-16(20-21-18)14-8-19-15-5-3-2-4-13(14)15;5-3(6)1-2-4(7)8/h2-8,12,17,19H,9-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t12-,17+;/m1./s1 |
| InChIKey | DTXKAZBITYXMCG-AIMKETPSSA-N |
| XLogP | 2.09 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|