C23H25BrN4O3S — CID 159203340
(1S,5S)-3-[6-(4-bromophenyl)pyridazin-3-yl]-6-methyl-3,6-diazabicyclo[3.2.0]heptane;4-methylbenzenesulfonic acid (PubChem CID 159203340) has the molecular formula C23H25BrN4O3S and a molecular weight of 517.45 g/mol. Its IUPAC name is (1S,5S)-3-[6-(4-bromophenyl)pyridazin-3-yl]-6-methyl-3,6-diazabicyclo[3.2.0]heptane;4-methylbenzenesulfonic acid.
| Compound Name | (1S,5S)-3-[6-(4-bromophenyl)pyridazin-3-yl]-6-methyl-3,6-diazabicyclo[3.2.0]heptane;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 159203340 |
| Molecular Formula | C23H25BrN4O3S |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | (1S,5S)-3-[6-(4-bromophenyl)pyridazin-3-yl]-6-methyl-3,6-diazabicyclo[3.2.0]heptane;4-methylbenzenesulfonic acid |
| SMILES | CN1C[C@H]2CN(c3ccc(-c4ccc(Br)cc4)nn3)C[C@H]21.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H17BrN4.C7H8O3S/c1-20-8-12-9-21(10-15(12)20)16-7-6-14(18-19-16)11-2-4-13(17)5-3-11;1-6-2-4-7(5-3-6)11(8,9)10/h2-7,12,15H,8-10H2,1H3;2-5H,1H3,(H,8,9,10)/t12-,15+;/m0./s1 |
| InChIKey | KPOLLKSXHNKEPJ-SBKWZQTDSA-N |
| XLogP | 3.90 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|