C16H20N6 — CID 141156493
[4-[6-(6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)pyridazin-3-yl]phenyl]hydrazine (PubChem CID 141156493) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is [4-[6-(6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)pyridazin-3-yl]phenyl]hydrazine.
| Compound Name | [4-[6-(6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)pyridazin-3-yl]phenyl]hydrazine |
|---|---|
| PubChem CID | 141156493 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | [4-[6-(6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl)pyridazin-3-yl]phenyl]hydrazine |
| SMILES | CN1CC2CN(c3ccc(-c4ccc(NN)cc4)nn3)CC21 |
| InChI | InChI=1S/C16H20N6/c1-21-8-12-9-22(10-15(12)21)16-7-6-14(19-20-16)11-2-4-13(18-17)5-3-11/h2-7,12,15,18H,8-10,17H2,1H3 |
| InChIKey | MYMMJAIRKROKNG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|