C21H25N5O6S — CID 67162694
N-[4-[6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridazin-3-yl]phenyl]methanesulfonamide;but-2-enedioic acid (PubChem CID 67162694) has the molecular formula C21H25N5O6S and a molecular weight of 475.53 g/mol. Its IUPAC name is N-[4-[6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridazin-3-yl]phenyl]methanesulfonamide;but-2-enedioic acid.
| Compound Name | N-[4-[6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridazin-3-yl]phenyl]methanesulfonamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 67162694 |
| Molecular Formula | C21H25N5O6S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[4-[6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridazin-3-yl]phenyl]methanesulfonamide;but-2-enedioic acid |
| SMILES | CS(=O)(=O)Nc1ccc(-c2ccc(N3CC4CNCC4C3)nn2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H21N5O2S.C4H4O4/c1-25(23,24)21-15-4-2-12(3-5-15)16-6-7-17(20-19-16)22-10-13-8-18-9-14(13)11-22;5-3(6)1-2-4(7)8/h2-7,13-14,18,21H,8-11H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | DQODHOAGQQHJSI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|