C26H32N4O2S — CID 121031479
4-tert-butyl-N-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide (PubChem CID 121031479) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121031479 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 4-tert-butyl-N-[4-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]benzenesulfonamide |
| SMILES | CC1CCN(c2ccc(-c3ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)cc3)nn2)CC1 |
| InChI | InChI=1S/C26H32N4O2S/c1-19-15-17-30(18-16-19)25-14-13-24(27-28-25)20-5-9-22(10-6-20)29-33(31,32)23-11-7-21(8-12-23)26(2,3)4/h5-14,19,29H,15-18H2,1-4H3 |
| InChIKey | CCGDCIAMTPJWFV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |