C18H23IN4 — CID 56667084
5,5-dimethyl-2-(6-phenylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-ium iodide (PubChem CID 56667084) has the molecular formula C18H23IN4 and a molecular weight of 422.31 g/mol. Its IUPAC name is 5,5-dimethyl-2-(6-phenylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-ium iodide.
| Compound Name | 5,5-dimethyl-2-(6-phenylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-ium iodide |
|---|---|
| PubChem CID | 56667084 |
| Molecular Formula | C18H23IN4 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 5,5-dimethyl-2-(6-phenylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-ium iodide |
| SMILES | C[N+]1(C)CC2CN(c3ccc(-c4ccccc4)nn3)CC2C1.[I-] |
| InChI | InChI=1S/C18H23N4.HI/c1-22(2)12-15-10-21(11-16(15)13-22)18-9-8-17(19-20-18)14-6-4-3-5-7-14;/h3-9,15-16H,10-13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QTGSYYACZZPPQD-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|