C22H23N5 — CID 126422429
(3aS,6aS)-2-benzyl-5-(6-pyridin-4-ylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 126422429) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is (3aS,6aS)-2-benzyl-5-(6-pyridin-4-ylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aS)-2-benzyl-5-(6-pyridin-4-ylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 126422429 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | (3aS,6aS)-2-benzyl-5-(6-pyridin-4-ylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | c1ccc(CN2C[C@H]3CN(c4ccc(-c5ccncc5)nn4)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C22H23N5/c1-2-4-17(5-3-1)12-26-13-19-15-27(16-20(19)14-26)22-7-6-21(24-25-22)18-8-10-23-11-9-18/h1-11,19-20H,12-16H2/t19-,20-/m0/s1 |
| InChIKey | QGFRAOOKXWDGOU-PMACEKPBSA-N |
| XLogP | 3.11 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |