C24H28N2O7S — CID 69438181
N-[4-[4-(1-azabicyclo[2.2.2]octan-3-yloxy)phenyl]phenyl]methanesulfonamide;(E)-but-2-enedioic acid (PubChem CID 69438181) has the molecular formula C24H28N2O7S and a molecular weight of 488.56 g/mol. Its IUPAC name is N-[4-[4-(1-azabicyclo[2.2.2]octan-3-yloxy)phenyl]phenyl]methanesulfonamide;(E)-but-2-enedioic acid.
| Compound Name | N-[4-[4-(1-azabicyclo[2.2.2]octan-3-yloxy)phenyl]phenyl]methanesulfonamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 69438181 |
| Molecular Formula | C24H28N2O7S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N-[4-[4-(1-azabicyclo[2.2.2]octan-3-yloxy)phenyl]phenyl]methanesulfonamide;(E)-but-2-enedioic acid |
| SMILES | CS(=O)(=O)Nc1ccc(-c2ccc(OC3CN4CCC3CC4)cc2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H24N2O3S.C4H4O4/c1-26(23,24)21-18-6-2-15(3-7-18)16-4-8-19(9-5-16)25-20-14-22-12-10-17(20)11-13-22;5-3(6)1-2-4(7)8/h2-9,17,20-21H,10-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | PGPWQGOAYSNXKP-WLHGVMLRSA-N |
| XLogP | 2.91 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|