C21H25N3O5S — CID 76852356
N-[4-(methanesulfonamido)phenyl]-2-[4-(4-methylphenoxy)piperidin-1-yl]-2-oxoacetamide (PubChem CID 76852356) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[4-(methanesulfonamido)phenyl]-2-[4-(4-methylphenoxy)piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[4-(methanesulfonamido)phenyl]-2-[4-(4-methylphenoxy)piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 76852356 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-[4-(methanesulfonamido)phenyl]-2-[4-(4-methylphenoxy)piperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(OC2CCN(C(=O)C(=O)Nc3ccc(NS(C)(=O)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-15-3-9-18(10-4-15)29-19-11-13-24(14-12-19)21(26)20(25)22-16-5-7-17(8-6-16)23-30(2,27)28/h3-10,19,23H,11-14H2,1-2H3,(H,22,25) |
| InChIKey | RICKJOWSKNXIEY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|