C22H24N2O3 — CID 47695218
N-(2,3-dihydro-1H-inden-5-yl)-2-oxo-2-(4-phenoxypiperidin-1-yl)acetamide (PubChem CID 47695218) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2-oxo-2-(4-phenoxypiperidin-1-yl)acetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2-oxo-2-(4-phenoxypiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 47695218 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2-oxo-2-(4-phenoxypiperidin-1-yl)acetamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)C(=O)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24N2O3/c25-21(23-18-10-9-16-5-4-6-17(16)15-18)22(26)24-13-11-20(12-14-24)27-19-7-2-1-3-8-19/h1-3,7-10,15,20H,4-6,11-14H2,(H,23,25) |
| InChIKey | FESIPJRISCRWNJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|