C25H30N4O4S — CID 56663654
5-[6-(4-methoxyphenyl)pyridazin-3-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;4-methylbenzenesulfonic acid (PubChem CID 56663654) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is 5-[6-(4-methoxyphenyl)pyridazin-3-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;4-methylbenzenesulfonic acid.
| Compound Name | 5-[6-(4-methoxyphenyl)pyridazin-3-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 56663654 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 5-[6-(4-methoxyphenyl)pyridazin-3-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;4-methylbenzenesulfonic acid |
| SMILES | COc1ccc(-c2ccc(N3CC4CN(C)CC4C3)nn2)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H22N4O.C7H8O3S/c1-21-9-14-11-22(12-15(14)10-21)18-8-7-17(19-20-18)13-3-5-16(23-2)6-4-13;1-6-2-4-7(5-3-6)11(8,9)10/h3-8,14-15H,9-12H2,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | VBLZFRIZOVOAOP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|