C20H28N2O6S2 — CID 131887991
1,4-diazabicyclo[2.2.2]octane;bis(4-methylbenzenesulfonic acid) (PubChem CID 131887991) has the molecular formula C20H28N2O6S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;bis(4-methylbenzenesulfonic acid).
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 131887991 |
| Molecular Formula | C20H28N2O6S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;bis(4-methylbenzenesulfonic acid) |
| SMILES | C1CN2CCN1CC2.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/2C7H8O3S.C6H12N2/c2*1-6-2-4-7(5-3-6)11(8,9)10;1-2-8-5-3-7(1)4-6-8/h2*2-5H,1H3,(H,8,9,10);1-6H2 |
| InChIKey | NUKKGWZEIYATPX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|