C16H22N2O3 — CID 90192463
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-(2-methoxyphenyl)acetate (PubChem CID 90192463) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-(2-methoxyphenyl)acetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-(2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 90192463 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-(2-methoxyphenyl)acetate |
| SMILES | COc1ccccc1C(N)C(=O)O[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C16H22N2O3/c1-20-13-5-3-2-4-12(13)15(17)16(19)21-14-10-18-8-6-11(14)7-9-18/h2-5,11,14-15H,6-10,17H2,1H3/t14-,15?/m0/s1 |
| InChIKey | XBIXNVRKFSFUSL-MLCCFXAWSA-N |
| XLogP | 1.33 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |