C14H19N3O2 — CID 90192466
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-pyridin-3-ylacetate (PubChem CID 90192466) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-pyridin-3-ylacetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-pyridin-3-ylacetate |
|---|---|
| PubChem CID | 90192466 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-amino-2-pyridin-3-ylacetate |
| SMILES | NC(C(=O)O[C@H]1CN2CCC1CC2)c1cccnc1 |
| InChI | InChI=1S/C14H19N3O2/c15-13(11-2-1-5-16-8-11)14(18)19-12-9-17-6-3-10(12)4-7-17/h1-2,5,8,10,12-13H,3-4,6-7,9,15H2/t12-,13?/m0/s1 |
| InChIKey | MVWBEBLCZQOWGX-UEWDXFNNSA-N |
| XLogP | 0.72 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |