C16H19N5O2 — CID 67901153
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(tetrazol-1-yl)acetate (PubChem CID 67901153) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(tetrazol-1-yl)acetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(tetrazol-1-yl)acetate |
|---|---|
| PubChem CID | 67901153 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(tetrazol-1-yl)acetate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)C(c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C16H19N5O2/c22-16(23-14-10-20-8-6-12(14)7-9-20)15(21-11-17-18-19-21)13-4-2-1-3-5-13/h1-5,11-12,14-15H,6-10H2/t14-,15?/m0/s1 |
| InChIKey | VSYYGBUZLLNCEA-MLCCFXAWSA-N |
| XLogP | 0.90 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |